C19H17NO6 — CID 4233238
3-(carboxymethyl)-2-(2,5-dimethoxyphenyl)-1H-indole-5-carboxylic acid (PubChem CID 4233238) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is 3-(carboxymethyl)-2-(2,5-dimethoxyphenyl)-1H-indole-5-carboxylic acid.
| Compound Name | 3-(carboxymethyl)-2-(2,5-dimethoxyphenyl)-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 4233238 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 3-(carboxymethyl)-2-(2,5-dimethoxyphenyl)-1H-indole-5-carboxylic acid |
| SMILES | COc1ccc(OC)c(-c2[nH]c3ccc(C(=O)O)cc3c2CC(=O)O)c1 |
| InChI | InChI=1S/C19H17NO6/c1-25-11-4-6-16(26-2)14(8-11)18-13(9-17(21)22)12-7-10(19(23)24)3-5-15(12)20-18/h3-8,20H,9H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | WPMMSHPFEOHYLH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |