C19H19NO3 — CID 3579332
2-[2-(2,5-dimethylphenyl)-5-methoxy-1H-indol-3-yl]acetic acid (PubChem CID 3579332) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylphenyl)-5-methoxy-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(2,5-dimethylphenyl)-5-methoxy-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3579332 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[2-(2,5-dimethylphenyl)-5-methoxy-1H-indol-3-yl]acetic acid |
| SMILES | COc1ccc2[nH]c(-c3cc(C)ccc3C)c(CC(=O)O)c2c1 |
| InChI | InChI=1S/C19H19NO3/c1-11-4-5-12(2)14(8-11)19-16(10-18(21)22)15-9-13(23-3)6-7-17(15)20-19/h4-9,20H,10H2,1-3H3,(H,21,22) |
| InChIKey | SVLDBCFADSIZKG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |