C20H19F2NO3 — CID 5105644
2-[5-butoxy-2-(2,4-difluorophenyl)-1H-indol-3-yl]acetic acid (PubChem CID 5105644) has the molecular formula C20H19F2NO3 and a molecular weight of 359.37 g/mol. Its IUPAC name is 2-[5-butoxy-2-(2,4-difluorophenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[5-butoxy-2-(2,4-difluorophenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 5105644 |
| Molecular Formula | C20H19F2NO3 |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-[5-butoxy-2-(2,4-difluorophenyl)-1H-indol-3-yl]acetic acid |
| SMILES | CCCCOc1ccc2[nH]c(-c3ccc(F)cc3F)c(CC(=O)O)c2c1 |
| InChI | InChI=1S/C20H19F2NO3/c1-2-3-8-26-13-5-7-18-15(10-13)16(11-19(24)25)20(23-18)14-6-4-12(21)9-17(14)22/h4-7,9-10,23H,2-3,8,11H2,1H3,(H,24,25) |
| InChIKey | WHPHSWSXDKUTKI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|