C18H16FNO2 — CID 5212090
2-[5-ethyl-2-(4-fluorophenyl)-1H-indol-3-yl]acetic acid (PubChem CID 5212090) has the molecular formula C18H16FNO2 and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-[5-ethyl-2-(4-fluorophenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[5-ethyl-2-(4-fluorophenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 5212090 |
| Molecular Formula | C18H16FNO2 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[5-ethyl-2-(4-fluorophenyl)-1H-indol-3-yl]acetic acid |
| SMILES | CCc1ccc2[nH]c(-c3ccc(F)cc3)c(CC(=O)O)c2c1 |
| InChI | InChI=1S/C18H16FNO2/c1-2-11-3-8-16-14(9-11)15(10-17(21)22)18(20-16)12-4-6-13(19)7-5-12/h3-9,20H,2,10H2,1H3,(H,21,22) |
| InChIKey | SCRWHQROYANOLR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |