C19H19NO2S — CID 3936804
2-[5-ethyl-2-(4-methylsulfanylphenyl)-1H-indol-3-yl]acetic acid (PubChem CID 3936804) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-[5-ethyl-2-(4-methylsulfanylphenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[5-ethyl-2-(4-methylsulfanylphenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3936804 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-[5-ethyl-2-(4-methylsulfanylphenyl)-1H-indol-3-yl]acetic acid |
| SMILES | CCc1ccc2[nH]c(-c3ccc(SC)cc3)c(CC(=O)O)c2c1 |
| InChI | InChI=1S/C19H19NO2S/c1-3-12-4-9-17-15(10-12)16(11-18(21)22)19(20-17)13-5-7-14(23-2)8-6-13/h4-10,20H,3,11H2,1-2H3,(H,21,22) |
| InChIKey | INSXAZHSZFKVSK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |