C20H21NO2S — CID 3596944
2-[2-(4-methylsulfanylphenyl)-7-propan-2-yl-1H-indol-3-yl]acetic acid (PubChem CID 3596944) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is 2-[2-(4-methylsulfanylphenyl)-7-propan-2-yl-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(4-methylsulfanylphenyl)-7-propan-2-yl-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3596944 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-[2-(4-methylsulfanylphenyl)-7-propan-2-yl-1H-indol-3-yl]acetic acid |
| SMILES | CSc1ccc(-c2[nH]c3c(C(C)C)cccc3c2CC(=O)O)cc1 |
| InChI | InChI=1S/C20H21NO2S/c1-12(2)15-5-4-6-16-17(11-18(22)23)19(21-20(15)16)13-7-9-14(24-3)10-8-13/h4-10,12,21H,11H2,1-3H3,(H,22,23) |
| InChIKey | IPGTZGIRBWLNNX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |