C23H19NO3S — CID 3537629
2-[2-(4-methylsulfanylphenyl)-5-phenoxy-1H-indol-3-yl]acetic acid (PubChem CID 3537629) has the molecular formula C23H19NO3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-[2-(4-methylsulfanylphenyl)-5-phenoxy-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(4-methylsulfanylphenyl)-5-phenoxy-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3537629 |
| Molecular Formula | C23H19NO3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-[2-(4-methylsulfanylphenyl)-5-phenoxy-1H-indol-3-yl]acetic acid |
| SMILES | CSc1ccc(-c2[nH]c3ccc(Oc4ccccc4)cc3c2CC(=O)O)cc1 |
| InChI | InChI=1S/C23H19NO3S/c1-28-18-10-7-15(8-11-18)23-20(14-22(25)26)19-13-17(9-12-21(19)24-23)27-16-5-3-2-4-6-16/h2-13,24H,14H2,1H3,(H,25,26) |
| InChIKey | HPFLMWZTAVCCKK-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |