C26H25NO4 — CID 3948737
2-[5-butoxy-2-(3-phenoxyphenyl)-1H-indol-3-yl]acetic acid (PubChem CID 3948737) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[5-butoxy-2-(3-phenoxyphenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[5-butoxy-2-(3-phenoxyphenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3948737 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[5-butoxy-2-(3-phenoxyphenyl)-1H-indol-3-yl]acetic acid |
| SMILES | CCCCOc1ccc2[nH]c(-c3cccc(Oc4ccccc4)c3)c(CC(=O)O)c2c1 |
| InChI | InChI=1S/C26H25NO4/c1-2-3-14-30-20-12-13-24-22(16-20)23(17-25(28)29)26(27-24)18-8-7-11-21(15-18)31-19-9-5-4-6-10-19/h4-13,15-16,27H,2-3,14,17H2,1H3,(H,28,29) |
| InChIKey | ULNFGCMOWNSTLR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|