C26H28N2O2 — CID 4309736
4-[5-ethoxy-2-(3-phenoxyphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4309736) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-[5-ethoxy-2-(3-phenoxyphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-ethoxy-2-(3-phenoxyphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4309736 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 4-[5-ethoxy-2-(3-phenoxyphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCOc1ccc2[nH]c(-c3cccc(Oc4ccccc4)c3)c(CCCCN)c2c1 |
| InChI | InChI=1S/C26H28N2O2/c1-2-29-21-14-15-25-24(18-21)23(13-6-7-16-27)26(28-25)19-9-8-12-22(17-19)30-20-10-4-3-5-11-20/h3-5,8-12,14-15,17-18,28H,2,6-7,13,16,27H2,1H3 |
| InChIKey | VUCBKTALCWSGGM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|