C21H21N3OS — CID 5253116
4-[5-phenoxy-2-(1,3-thiazol-2-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 5253116) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is 4-[5-phenoxy-2-(1,3-thiazol-2-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-phenoxy-2-(1,3-thiazol-2-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 5253116 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-[5-phenoxy-2-(1,3-thiazol-2-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2nccs2)[nH]c2ccc(Oc3ccccc3)cc12 |
| InChI | InChI=1S/C21H21N3OS/c22-11-5-4-8-17-18-14-16(25-15-6-2-1-3-7-15)9-10-19(18)24-20(17)21-23-12-13-26-21/h1-3,6-7,9-10,12-14,24H,4-5,8,11,22H2 |
| InChIKey | BDFNFWRKCIRTOY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|