C23H23BrN2OS — CID 5131275
4-[2-(5-bromothiophen-2-yl)-5-phenylmethoxy-1H-indol-3-yl]butan-1-amine (PubChem CID 5131275) has the molecular formula C23H23BrN2OS and a molecular weight of 455.42 g/mol. Its IUPAC name is 4-[2-(5-bromothiophen-2-yl)-5-phenylmethoxy-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(5-bromothiophen-2-yl)-5-phenylmethoxy-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 5131275 |
| Molecular Formula | C23H23BrN2OS |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 4-[2-(5-bromothiophen-2-yl)-5-phenylmethoxy-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccc(Br)s2)[nH]c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C23H23BrN2OS/c24-22-12-11-21(28-22)23-18(8-4-5-13-25)19-14-17(9-10-20(19)26-23)27-15-16-6-2-1-3-7-16/h1-3,6-7,9-12,14,26H,4-5,8,13,15,25H2 |
| InChIKey | RBTUOTBATQQSSF-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|