C17H16BrF3N2S — CID 3477532
4-[2-(5-bromothiophen-2-yl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3477532) has the molecular formula C17H16BrF3N2S and a molecular weight of 417.29 g/mol. Its IUPAC name is 4-[2-(5-bromothiophen-2-yl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(5-bromothiophen-2-yl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3477532 |
| Molecular Formula | C17H16BrF3N2S |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 4-[2-(5-bromothiophen-2-yl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccc(Br)s2)[nH]c2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C17H16BrF3N2S/c18-14-8-7-13(24-14)16-11(4-1-2-9-22)10-5-3-6-12(15(10)23-16)17(19,20)21/h3,5-8,23H,1-2,4,9,22H2 |
| InChIKey | GNGJPMXQLPFFDT-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|