C16H15BrCl2N2S — CID 3349595
4-[7-bromo-5-chloro-2-(5-chlorothiophen-2-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3349595) has the molecular formula C16H15BrCl2N2S and a molecular weight of 418.19 g/mol. Its IUPAC name is 4-[7-bromo-5-chloro-2-(5-chlorothiophen-2-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[7-bromo-5-chloro-2-(5-chlorothiophen-2-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3349595 |
| Molecular Formula | C16H15BrCl2N2S |
| Molecular Weight | 418.19 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | 4-[7-bromo-5-chloro-2-(5-chlorothiophen-2-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccc(Cl)s2)[nH]c2c(Br)cc(Cl)cc12 |
| InChI | InChI=1S/C16H15BrCl2N2S/c17-12-8-9(18)7-11-10(3-1-2-6-20)16(21-15(11)12)13-4-5-14(19)22-13/h4-5,7-8,21H,1-3,6,20H2 |
| InChIKey | FOFGYCUAZKMCJW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.19 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|