C19H20BrClN2O — CID 3608432
4-[7-bromo-5-chloro-2-(3-methoxyphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3608432) has the molecular formula C19H20BrClN2O and a molecular weight of 407.74 g/mol. Its IUPAC name is 4-[7-bromo-5-chloro-2-(3-methoxyphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[7-bromo-5-chloro-2-(3-methoxyphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3608432 |
| Molecular Formula | C19H20BrClN2O |
| Molecular Weight | 407.74 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 4-[7-bromo-5-chloro-2-(3-methoxyphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1cccc(-c2[nH]c3c(Br)cc(Cl)cc3c2CCCCN)c1 |
| InChI | InChI=1S/C19H20BrClN2O/c1-24-14-6-4-5-12(9-14)18-15(7-2-3-8-22)16-10-13(21)11-17(20)19(16)23-18/h4-6,9-11,23H,2-3,7-8,22H2,1H3 |
| InChIKey | KHHPXDBEHOCKHF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.74 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|