C18H18Cl2N2 — CID 3460456
4-(5,7-dichloro-2-phenyl-1H-indol-3-yl)butan-1-amine (PubChem CID 3460456) has the molecular formula C18H18Cl2N2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 4-(5,7-dichloro-2-phenyl-1H-indol-3-yl)butan-1-amine.
| Compound Name | 4-(5,7-dichloro-2-phenyl-1H-indol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 3460456 |
| Molecular Formula | C18H18Cl2N2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 4-(5,7-dichloro-2-phenyl-1H-indol-3-yl)butan-1-amine |
| SMILES | NCCCCc1c(-c2ccccc2)[nH]c2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C18H18Cl2N2/c19-13-10-15-14(8-4-5-9-21)17(12-6-2-1-3-7-12)22-18(15)16(20)11-13/h1-3,6-7,10-11,22H,4-5,8-9,21H2 |
| InChIKey | OHPFRWIHXVAPEK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|