C22H27ClN2 — CID 4574426
4-[2-(4-tert-butylphenyl)-7-chloro-1H-indol-3-yl]butan-1-amine (PubChem CID 4574426) has the molecular formula C22H27ClN2 and a molecular weight of 354.93 g/mol. Its IUPAC name is 4-[2-(4-tert-butylphenyl)-7-chloro-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(4-tert-butylphenyl)-7-chloro-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4574426 |
| Molecular Formula | C22H27ClN2 |
| Molecular Weight | 354.93 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 4-[2-(4-tert-butylphenyl)-7-chloro-1H-indol-3-yl]butan-1-amine |
| SMILES | CC(C)(C)c1ccc(-c2[nH]c3c(Cl)cccc3c2CCCCN)cc1 |
| InChI | InChI=1S/C22H27ClN2/c1-22(2,3)16-12-10-15(11-13-16)20-17(7-4-5-14-24)18-8-6-9-19(23)21(18)25-20/h6,8-13,25H,4-5,7,14,24H2,1-3H3 |
| InChIKey | OMQFQLFTEXIYCP-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.93 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|