C20H23BrN2 — CID 5138431
4-[7-bromo-2-(4-ethylphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 5138431) has the molecular formula C20H23BrN2 and a molecular weight of 371.32 g/mol. Its IUPAC name is 4-[7-bromo-2-(4-ethylphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[7-bromo-2-(4-ethylphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 5138431 |
| Molecular Formula | C20H23BrN2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 4-[7-bromo-2-(4-ethylphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCc1ccc(-c2[nH]c3c(Br)cccc3c2CCCCN)cc1 |
| InChI | InChI=1S/C20H23BrN2/c1-2-14-9-11-15(12-10-14)19-16(6-3-4-13-22)17-7-5-8-18(21)20(17)23-19/h5,7-12,23H,2-4,6,13,22H2,1H3 |
| InChIKey | YZHJAVZGKDZCFF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|