C20H23ClN2 — CID 3990175
4-[5-chloro-2-(4-ethylphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3990175) has the molecular formula C20H23ClN2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 4-[5-chloro-2-(4-ethylphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-chloro-2-(4-ethylphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3990175 |
| Molecular Formula | C20H23ClN2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-[5-chloro-2-(4-ethylphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCc1ccc(-c2[nH]c3ccc(Cl)cc3c2CCCCN)cc1 |
| InChI | InChI=1S/C20H23ClN2/c1-2-14-6-8-15(9-7-14)20-17(5-3-4-12-22)18-13-16(21)10-11-19(18)23-20/h6-11,13,23H,2-5,12,22H2,1H3 |
| InChIKey | RBAUQAFVYVIGFV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|