C19H18ClN3 — CID 3688893
3-(4-aminobutyl)-2-(4-chlorophenyl)-1H-indole-5-carbonitrile (PubChem CID 3688893) has the molecular formula C19H18ClN3 and a molecular weight of 323.83 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-(4-chlorophenyl)-1H-indole-5-carbonitrile.
| Compound Name | 3-(4-aminobutyl)-2-(4-chlorophenyl)-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 3688893 |
| Molecular Formula | C19H18ClN3 |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-(4-aminobutyl)-2-(4-chlorophenyl)-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]c(-c3ccc(Cl)cc3)c(CCCCN)c2c1 |
| InChI | InChI=1S/C19H18ClN3/c20-15-7-5-14(6-8-15)19-16(3-1-2-10-21)17-11-13(12-22)4-9-18(17)23-19/h4-9,11,23H,1-3,10,21H2 |
| InChIKey | TWZATHAPBZXDRQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|