C20H24N2 — CID 4033296
4-[5-methyl-2-(4-methylphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4033296) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 4-[5-methyl-2-(4-methylphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-methyl-2-(4-methylphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4033296 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 4-[5-methyl-2-(4-methylphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1ccc(-c2[nH]c3ccc(C)cc3c2CCCCN)cc1 |
| InChI | InChI=1S/C20H24N2/c1-14-6-9-16(10-7-14)20-17(5-3-4-12-21)18-13-15(2)8-11-19(18)22-20/h6-11,13,22H,3-5,12,21H2,1-2H3 |
| InChIKey | BOHWMRLZGMYCFF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|