C22H29N3 — CID 3525871
4-[3-(4-aminobutyl)-5-ethyl-1H-indol-2-yl]-N,N-dimethylaniline (PubChem CID 3525871) has the molecular formula C22H29N3 and a molecular weight of 335.50 g/mol. Its IUPAC name is 4-[3-(4-aminobutyl)-5-ethyl-1H-indol-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[3-(4-aminobutyl)-5-ethyl-1H-indol-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3525871 |
| Molecular Formula | C22H29N3 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 4-[3-(4-aminobutyl)-5-ethyl-1H-indol-2-yl]-N,N-dimethylaniline |
| SMILES | CCc1ccc2[nH]c(-c3ccc(N(C)C)cc3)c(CCCCN)c2c1 |
| InChI | InChI=1S/C22H29N3/c1-4-16-8-13-21-20(15-16)19(7-5-6-14-23)22(24-21)17-9-11-18(12-10-17)25(2)3/h8-13,15,24H,4-7,14,23H2,1-3H3 |
| InChIKey | KVGGAHPIOJBMLK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|