C21H27N3O — CID 3997182
4-[3-(4-aminobutyl)-5-methoxy-1H-indol-2-yl]-N,N-dimethylaniline (PubChem CID 3997182) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 4-[3-(4-aminobutyl)-5-methoxy-1H-indol-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[3-(4-aminobutyl)-5-methoxy-1H-indol-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3997182 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 4-[3-(4-aminobutyl)-5-methoxy-1H-indol-2-yl]-N,N-dimethylaniline |
| SMILES | COc1ccc2[nH]c(-c3ccc(N(C)C)cc3)c(CCCCN)c2c1 |
| InChI | InChI=1S/C21H27N3O/c1-24(2)16-9-7-15(8-10-16)21-18(6-4-5-13-22)19-14-17(25-3)11-12-20(19)23-21/h7-12,14,23H,4-6,13,22H2,1-3H3 |
| InChIKey | LYWCOXSZCWLKGR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|