C21H24N2O3 — CID 3605261
4-[2-(1,3-benzodioxol-5-yl)-5-ethoxy-1H-indol-3-yl]butan-1-amine (PubChem CID 3605261) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-yl)-5-ethoxy-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(1,3-benzodioxol-5-yl)-5-ethoxy-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3605261 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-yl)-5-ethoxy-1H-indol-3-yl]butan-1-amine |
| SMILES | CCOc1ccc2[nH]c(-c3ccc4c(c3)OCO4)c(CCCCN)c2c1 |
| InChI | InChI=1S/C21H24N2O3/c1-2-24-15-7-8-18-17(12-15)16(5-3-4-10-22)21(23-18)14-6-9-19-20(11-14)26-13-25-19/h6-9,11-12,23H,2-5,10,13,22H2,1H3 |
| InChIKey | QOAYRRDVUIFCJQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 69.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|