C20H22N2O2 — CID 3575438
4-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3575438) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3575438 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 4-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccc3c(c2)OCCO3)[nH]c2ccccc12 |
| InChI | InChI=1S/C20H22N2O2/c21-10-4-3-6-16-15-5-1-2-7-17(15)22-20(16)14-8-9-18-19(13-14)24-12-11-23-18/h1-2,5,7-9,13,22H,3-4,6,10-12,21H2 |
| InChIKey | BCUGOSAOZDNWBJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|