C19H22N2 — CID 67663685
3-[2-(3,5-dimethylphenyl)-1H-indol-3-yl]propan-1-amine (PubChem CID 67663685) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylphenyl)-1H-indol-3-yl]propan-1-amine.
| Compound Name | 3-[2-(3,5-dimethylphenyl)-1H-indol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 67663685 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 3-[2-(3,5-dimethylphenyl)-1H-indol-3-yl]propan-1-amine |
| SMILES | Cc1cc(C)cc(-c2[nH]c3ccccc3c2CCCN)c1 |
| InChI | InChI=1S/C19H22N2/c1-13-10-14(2)12-15(11-13)19-17(7-5-9-20)16-6-3-4-8-18(16)21-19/h3-4,6,8,10-12,21H,5,7,9,20H2,1-2H3 |
| InChIKey | QSTBMYOLEADXFQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |