C24H23ClN2 — CID 5035921
4-[5-chloro-2-(4-phenylphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 5035921) has the molecular formula C24H23ClN2 and a molecular weight of 374.92 g/mol. Its IUPAC name is 4-[5-chloro-2-(4-phenylphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-chloro-2-(4-phenylphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 5035921 |
| Molecular Formula | C24H23ClN2 |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 4-[5-chloro-2-(4-phenylphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccc(-c3ccccc3)cc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H23ClN2/c25-20-13-14-23-22(16-20)21(8-4-5-15-26)24(27-23)19-11-9-18(10-12-19)17-6-2-1-3-7-17/h1-3,6-7,9-14,16,27H,4-5,8,15,26H2 |
| InChIKey | YQIRTHAVUYIUQY-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|