C18H19FN2 — CID 3946658
4-[2-(4-fluorophenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3946658) has the molecular formula C18H19FN2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(4-fluorophenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3946658 |
| Molecular Formula | C18H19FN2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-[2-(4-fluorophenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccc(F)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C18H19FN2/c19-14-10-8-13(9-11-14)18-16(6-3-4-12-20)15-5-1-2-7-17(15)21-18/h1-2,5,7-11,21H,3-4,6,12,20H2 |
| InChIKey | LUIPNWRRDBGAMJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|