C19H18ClF3N2 — CID 3565408
4-[2-[4-chloro-3-(trifluoromethyl)phenyl]-1H-indol-3-yl]butan-1-amine (PubChem CID 3565408) has the molecular formula C19H18ClF3N2 and a molecular weight of 366.81 g/mol. Its IUPAC name is 4-[2-[4-chloro-3-(trifluoromethyl)phenyl]-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-[4-chloro-3-(trifluoromethyl)phenyl]-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3565408 |
| Molecular Formula | C19H18ClF3N2 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 4-[2-[4-chloro-3-(trifluoromethyl)phenyl]-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccc(Cl)c(C(F)(F)F)c2)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H18ClF3N2/c20-16-9-8-12(11-15(16)19(21,22)23)18-14(6-3-4-10-24)13-5-1-2-7-17(13)25-18/h1-2,5,7-9,11,25H,3-4,6,10,24H2 |
| InChIKey | OCHIRNIPXHIKOX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|