C23H26ClF3N2 — CID 3252240
4-[5-butan-2-yl-2-[4-chloro-3-(trifluoromethyl)phenyl]-1H-indol-3-yl]butan-1-amine (PubChem CID 3252240) has the molecular formula C23H26ClF3N2 and a molecular weight of 422.92 g/mol. Its IUPAC name is 4-[5-butan-2-yl-2-[4-chloro-3-(trifluoromethyl)phenyl]-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-butan-2-yl-2-[4-chloro-3-(trifluoromethyl)phenyl]-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3252240 |
| Molecular Formula | C23H26ClF3N2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 4-[5-butan-2-yl-2-[4-chloro-3-(trifluoromethyl)phenyl]-1H-indol-3-yl]butan-1-amine |
| SMILES | CCC(C)c1ccc2[nH]c(-c3ccc(Cl)c(C(F)(F)F)c3)c(CCCCN)c2c1 |
| InChI | InChI=1S/C23H26ClF3N2/c1-3-14(2)15-8-10-21-18(12-15)17(6-4-5-11-28)22(29-21)16-7-9-20(24)19(13-16)23(25,26)27/h7-10,12-14,29H,3-6,11,28H2,1-2H3 |
| InChIKey | REZYHAXUJZOVAF-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|