C22H27IN2 — CID 3375410
4-[5-butan-2-yl-2-(2-iodophenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3375410) has the molecular formula C22H27IN2 and a molecular weight of 446.38 g/mol. Its IUPAC name is 4-[5-butan-2-yl-2-(2-iodophenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-butan-2-yl-2-(2-iodophenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3375410 |
| Molecular Formula | C22H27IN2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 4-[5-butan-2-yl-2-(2-iodophenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCC(C)c1ccc2[nH]c(-c3ccccc3I)c(CCCCN)c2c1 |
| InChI | InChI=1S/C22H27IN2/c1-3-15(2)16-11-12-21-19(14-16)17(8-6-7-13-24)22(25-21)18-9-4-5-10-20(18)23/h4-5,9-12,14-15,25H,3,6-8,13,24H2,1-2H3 |
| InChIKey | ILKXJNMHIRBVBV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|