C26H25NO2 — CID 5180331
2-[5-butan-2-yl-2-(4-phenylphenyl)-1H-indol-3-yl]acetic acid (PubChem CID 5180331) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-[5-butan-2-yl-2-(4-phenylphenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[5-butan-2-yl-2-(4-phenylphenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 5180331 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2-[5-butan-2-yl-2-(4-phenylphenyl)-1H-indol-3-yl]acetic acid |
| SMILES | CCC(C)c1ccc2[nH]c(-c3ccc(-c4ccccc4)cc3)c(CC(=O)O)c2c1 |
| InChI | InChI=1S/C26H25NO2/c1-3-17(2)21-13-14-24-22(15-21)23(16-25(28)29)26(27-24)20-11-9-19(10-12-20)18-7-5-4-6-8-18/h4-15,17,27H,3,16H2,1-2H3,(H,28,29) |
| InChIKey | DYEQODXTIMRLEG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |