C20H20ClNO2 — CID 3539679
2-[5-butan-2-yl-2-(3-chlorophenyl)-1H-indol-3-yl]acetic acid (PubChem CID 3539679) has the molecular formula C20H20ClNO2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 2-[5-butan-2-yl-2-(3-chlorophenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[5-butan-2-yl-2-(3-chlorophenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3539679 |
| Molecular Formula | C20H20ClNO2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-[5-butan-2-yl-2-(3-chlorophenyl)-1H-indol-3-yl]acetic acid |
| SMILES | CCC(C)c1ccc2[nH]c(-c3cccc(Cl)c3)c(CC(=O)O)c2c1 |
| InChI | InChI=1S/C20H20ClNO2/c1-3-12(2)13-7-8-18-16(10-13)17(11-19(23)24)20(22-18)14-5-4-6-15(21)9-14/h4-10,12,22H,3,11H2,1-2H3,(H,23,24) |
| InChIKey | RNVVLLXBKQAHED-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |