C24H21ClN2O — CID 177492325
2-[2-(3-chlorophenyl)-5-methyl-1H-indol-3-yl]-N-(4-methylphenyl)acetamide (PubChem CID 177492325) has the molecular formula C24H21ClN2O and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-5-methyl-1H-indol-3-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-(3-chlorophenyl)-5-methyl-1H-indol-3-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 177492325 |
| Molecular Formula | C24H21ClN2O |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-5-methyl-1H-indol-3-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2c(-c3cccc(Cl)c3)[nH]c3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C24H21ClN2O/c1-15-6-9-19(10-7-15)26-23(28)14-21-20-12-16(2)8-11-22(20)27-24(21)17-4-3-5-18(25)13-17/h3-13,27H,14H2,1-2H3,(H,26,28) |
| InChIKey | RJMBXKYQBZUNJN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |