C26H31N3O — CID 3357825
4-[5-butan-2-yl-2-(8-methoxyquinolin-5-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3357825) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is 4-[5-butan-2-yl-2-(8-methoxyquinolin-5-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-butan-2-yl-2-(8-methoxyquinolin-5-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3357825 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 4-[5-butan-2-yl-2-(8-methoxyquinolin-5-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCC(C)c1ccc2[nH]c(-c3ccc(OC)c4ncccc34)c(CCCCN)c2c1 |
| InChI | InChI=1S/C26H31N3O/c1-4-17(2)18-10-12-23-22(16-18)20(8-5-6-14-27)25(29-23)21-11-13-24(30-3)26-19(21)9-7-15-28-26/h7,9-13,15-17,29H,4-6,8,14,27H2,1-3H3 |
| InChIKey | STDHZNBCCIDOPQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|