C22H21Cl2N3O — CID 3502542
4-[6,7-dichloro-2-(8-methoxyquinolin-5-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3502542) has the molecular formula C22H21Cl2N3O and a molecular weight of 414.34 g/mol. Its IUPAC name is 4-[6,7-dichloro-2-(8-methoxyquinolin-5-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[6,7-dichloro-2-(8-methoxyquinolin-5-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3502542 |
| Molecular Formula | C22H21Cl2N3O |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 4-[6,7-dichloro-2-(8-methoxyquinolin-5-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1ccc(-c2[nH]c3c(Cl)c(Cl)ccc3c2CCCCN)c2cccnc12 |
| InChI | InChI=1S/C22H21Cl2N3O/c1-28-18-10-8-15(14-6-4-12-26-21(14)18)20-13(5-2-3-11-25)16-7-9-17(23)19(24)22(16)27-20/h4,6-10,12,27H,2-3,5,11,25H2,1H3 |
| InChIKey | JRLUGZXQVDMNBT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|