C25H22BrN3 — CID 4012728
4-[2-(5-bromoquinolin-8-yl)-1H-benzo[g]indol-3-yl]butan-1-amine (PubChem CID 4012728) has the molecular formula C25H22BrN3 and a molecular weight of 444.38 g/mol. Its IUPAC name is 4-[2-(5-bromoquinolin-8-yl)-1H-benzo[g]indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(5-bromoquinolin-8-yl)-1H-benzo[g]indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4012728 |
| Molecular Formula | C25H22BrN3 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 4-[2-(5-bromoquinolin-8-yl)-1H-benzo[g]indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccc(Br)c3cccnc23)[nH]c2c1ccc1ccccc12 |
| InChI | InChI=1S/C25H22BrN3/c26-22-13-12-21(23-20(22)9-5-15-28-23)25-18(8-3-4-14-27)19-11-10-16-6-1-2-7-17(16)24(19)29-25/h1-2,5-7,9-13,15,29H,3-4,8,14,27H2 |
| InChIKey | JOJNJDODUCSAKV-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|