C23H24BrN3O — CID 3331930
4-[2-(5-bromoquinolin-8-yl)-5-methoxy-7-methyl-1H-indol-3-yl]butan-1-amine (PubChem CID 3331930) has the molecular formula C23H24BrN3O and a molecular weight of 438.37 g/mol. Its IUPAC name is 4-[2-(5-bromoquinolin-8-yl)-5-methoxy-7-methyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(5-bromoquinolin-8-yl)-5-methoxy-7-methyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3331930 |
| Molecular Formula | C23H24BrN3O |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 4-[2-(5-bromoquinolin-8-yl)-5-methoxy-7-methyl-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1cc(C)c2[nH]c(-c3ccc(Br)c4cccnc34)c(CCCCN)c2c1 |
| InChI | InChI=1S/C23H24BrN3O/c1-14-12-15(28-2)13-19-16(6-3-4-10-25)23(27-21(14)19)18-8-9-20(24)17-7-5-11-26-22(17)18/h5,7-9,11-13,27H,3-4,6,10,25H2,1-2H3 |
| InChIKey | FFXXDYQEGSZDPJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|