C19H22ClN3 — CID 3434232
4-[2-(3-chloro-2-pyridinyl)-5,7-dimethyl-1H-indol-3-yl]butan-1-amine (PubChem CID 3434232) has the molecular formula C19H22ClN3 and a molecular weight of 327.86 g/mol. Its IUPAC name is 4-[2-(3-chloro-2-pyridinyl)-5,7-dimethyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(3-chloro-2-pyridinyl)-5,7-dimethyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3434232 |
| Molecular Formula | C19H22ClN3 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 4-[2-(3-chloro-2-pyridinyl)-5,7-dimethyl-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1cc(C)c2[nH]c(-c3ncccc3Cl)c(CCCCN)c2c1 |
| InChI | InChI=1S/C19H22ClN3/c1-12-10-13(2)17-15(11-12)14(6-3-4-8-21)18(23-17)19-16(20)7-5-9-22-19/h5,7,9-11,23H,3-4,6,8,21H2,1-2H3 |
| InChIKey | MLFCUSJRFGFMLS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|