C21H25BrN2 — CID 3383373
4-[7-bromo-2-(2,4,6-trimethylphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3383373) has the molecular formula C21H25BrN2 and a molecular weight of 385.35 g/mol. Its IUPAC name is 4-[7-bromo-2-(2,4,6-trimethylphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[7-bromo-2-(2,4,6-trimethylphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3383373 |
| Molecular Formula | C21H25BrN2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 4-[7-bromo-2-(2,4,6-trimethylphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1cc(C)c(-c2[nH]c3c(Br)cccc3c2CCCCN)c(C)c1 |
| InChI | InChI=1S/C21H25BrN2/c1-13-11-14(2)19(15(3)12-13)21-17(7-4-5-10-23)16-8-6-9-18(22)20(16)24-21/h6,8-9,11-12,24H,4-5,7,10,23H2,1-3H3 |
| InChIKey | IBEHWMMTWVZWBD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|