C15H16BrN3S — CID 4993717
4-[7-bromo-2-(1,3-thiazol-2-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4993717) has the molecular formula C15H16BrN3S and a molecular weight of 350.29 g/mol. Its IUPAC name is 4-[7-bromo-2-(1,3-thiazol-2-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[7-bromo-2-(1,3-thiazol-2-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4993717 |
| Molecular Formula | C15H16BrN3S |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 4-[7-bromo-2-(1,3-thiazol-2-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2nccs2)[nH]c2c(Br)cccc12 |
| InChI | InChI=1S/C15H16BrN3S/c16-12-6-3-5-10-11(4-1-2-7-17)14(19-13(10)12)15-18-8-9-20-15/h3,5-6,8-9,19H,1-2,4,7,17H2 |
| InChIKey | RBQGITRGRRYNBC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|