C17H19BrN2S — CID 3264919
4-[2-(3-bromothiophen-2-yl)-5-methyl-1H-indol-3-yl]butan-1-amine (PubChem CID 3264919) has the molecular formula C17H19BrN2S and a molecular weight of 363.32 g/mol. Its IUPAC name is 4-[2-(3-bromothiophen-2-yl)-5-methyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(3-bromothiophen-2-yl)-5-methyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3264919 |
| Molecular Formula | C17H19BrN2S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 4-[2-(3-bromothiophen-2-yl)-5-methyl-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1ccc2[nH]c(-c3sccc3Br)c(CCCCN)c2c1 |
| InChI | InChI=1S/C17H19BrN2S/c1-11-5-6-15-13(10-11)12(4-2-3-8-19)16(20-15)17-14(18)7-9-21-17/h5-7,9-10,20H,2-4,8,19H2,1H3 |
| InChIKey | WREXBWZCRGRKLJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|