C18H15BrF6N2S — CID 3891467
4-[2-(3-bromothiophen-2-yl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3891467) has the molecular formula C18H15BrF6N2S and a molecular weight of 485.29 g/mol. Its IUPAC name is 4-[2-(3-bromothiophen-2-yl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(3-bromothiophen-2-yl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3891467 |
| Molecular Formula | C18H15BrF6N2S |
| Molecular Weight | 485.29 g/mol |
| Exact Mass | 484.00 |
| IUPAC Name | 4-[2-(3-bromothiophen-2-yl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2sccc2Br)[nH]c2cc(C(F)(F)F)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C18H15BrF6N2S/c19-12-4-6-28-16(12)15-10(3-1-2-5-26)14-11(18(23,24)25)7-9(17(20,21)22)8-13(14)27-15/h4,6-8,27H,1-3,5,26H2 |
| InChIKey | NSVMFJCZFBMARX-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.29 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|