C26H22F6N2O — CID 4310336
4-[2-(3-phenoxyphenyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4310336) has the molecular formula C26H22F6N2O and a molecular weight of 492.46 g/mol. Its IUPAC name is 4-[2-(3-phenoxyphenyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(3-phenoxyphenyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4310336 |
| Molecular Formula | C26H22F6N2O |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 4-[2-(3-phenoxyphenyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2cccc(Oc3ccccc3)c2)[nH]c2cc(C(F)(F)F)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C26H22F6N2O/c27-25(28,29)17-14-21(26(30,31)32)23-20(11-4-5-12-33)24(34-22(23)15-17)16-7-6-10-19(13-16)35-18-8-2-1-3-9-18/h1-3,6-10,13-15,34H,4-5,11-12,33H2 |
| InChIKey | PJAGHENRQLMVDT-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|