C19H17ClF3IN2 — CID 3992197
4-[4-chloro-2-(3-iodophenyl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3992197) has the molecular formula C19H17ClF3IN2 and a molecular weight of 492.71 g/mol. Its IUPAC name is 4-[4-chloro-2-(3-iodophenyl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[4-chloro-2-(3-iodophenyl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3992197 |
| Molecular Formula | C19H17ClF3IN2 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | 4-[4-chloro-2-(3-iodophenyl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2cccc(I)c2)[nH]c2c(C(F)(F)F)ccc(Cl)c12 |
| InChI | InChI=1S/C19H17ClF3IN2/c20-15-8-7-14(19(21,22)23)18-16(15)13(6-1-2-9-25)17(26-18)11-4-3-5-12(24)10-11/h3-5,7-8,10,26H,1-2,6,9,25H2 |
| InChIKey | FFGFFCUWUWBLGV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|