C20H17ClF3N3S — CID 3494496
4-[2-(1,3-benzothiazol-2-yl)-4-chloro-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3494496) has the molecular formula C20H17ClF3N3S and a molecular weight of 423.89 g/mol. Its IUPAC name is 4-[2-(1,3-benzothiazol-2-yl)-4-chloro-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(1,3-benzothiazol-2-yl)-4-chloro-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3494496 |
| Molecular Formula | C20H17ClF3N3S |
| Molecular Weight | 423.89 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 4-[2-(1,3-benzothiazol-2-yl)-4-chloro-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2nc3ccccc3s2)[nH]c2c(C(F)(F)F)ccc(Cl)c12 |
| InChI | InChI=1S/C20H17ClF3N3S/c21-13-9-8-12(20(22,23)24)18-16(13)11(5-3-4-10-25)17(27-18)19-26-14-6-1-2-7-15(14)28-19/h1-2,6-9,27H,3-5,10,25H2 |
| InChIKey | XGSNPAMVFCROLD-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.89 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|