C21H21ClN2S — CID 3353814
4-[2-(1-benzothiophen-3-yl)-4-chloro-7-methyl-1H-indol-3-yl]butan-1-amine (PubChem CID 3353814) has the molecular formula C21H21ClN2S and a molecular weight of 368.93 g/mol. Its IUPAC name is 4-[2-(1-benzothiophen-3-yl)-4-chloro-7-methyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(1-benzothiophen-3-yl)-4-chloro-7-methyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3353814 |
| Molecular Formula | C21H21ClN2S |
| Molecular Weight | 368.93 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 4-[2-(1-benzothiophen-3-yl)-4-chloro-7-methyl-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1ccc(Cl)c2c(CCCCN)c(-c3csc4ccccc34)[nH]c12 |
| InChI | InChI=1S/C21H21ClN2S/c1-13-9-10-17(22)19-15(7-4-5-11-23)21(24-20(13)19)16-12-25-18-8-3-2-6-14(16)18/h2-3,6,8-10,12,24H,4-5,7,11,23H2,1H3 |
| InChIKey | OYLDCDCKLRIJIP-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.93 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|