C24H25ClN2O — CID 3449714
4-[4-chloro-2-(1-methoxynaphthalen-2-yl)-7-methyl-1H-indol-3-yl]butan-1-amine (PubChem CID 3449714) has the molecular formula C24H25ClN2O and a molecular weight of 392.93 g/mol. Its IUPAC name is 4-[4-chloro-2-(1-methoxynaphthalen-2-yl)-7-methyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[4-chloro-2-(1-methoxynaphthalen-2-yl)-7-methyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3449714 |
| Molecular Formula | C24H25ClN2O |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-[4-chloro-2-(1-methoxynaphthalen-2-yl)-7-methyl-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1c(-c2[nH]c3c(C)ccc(Cl)c3c2CCCCN)ccc2ccccc12 |
| InChI | InChI=1S/C24H25ClN2O/c1-15-10-13-20(25)21-18(9-5-6-14-26)23(27-22(15)21)19-12-11-16-7-3-4-8-17(16)24(19)28-2/h3-4,7-8,10-13,27H,5-6,9,14,26H2,1-2H3 |
| InChIKey | IZGPNXMFVAFJJI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|