C26H26N2O2 — CID 3538439
3-(4-aminobutyl)-7-methyl-2-(2-phenylphenyl)-1H-indole-4-carboxylic acid (PubChem CID 3538439) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-(4-aminobutyl)-7-methyl-2-(2-phenylphenyl)-1H-indole-4-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-7-methyl-2-(2-phenylphenyl)-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 3538439 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 3-(4-aminobutyl)-7-methyl-2-(2-phenylphenyl)-1H-indole-4-carboxylic acid |
| SMILES | Cc1ccc(C(=O)O)c2c(CCCCN)c(-c3ccccc3-c3ccccc3)[nH]c12 |
| InChI | InChI=1S/C26H26N2O2/c1-17-14-15-22(26(29)30)23-21(13-7-8-16-27)25(28-24(17)23)20-12-6-5-11-19(20)18-9-3-2-4-10-18/h2-6,9-12,14-15,28H,7-8,13,16,27H2,1H3,(H,29,30) |
| InChIKey | UAAXGIPNIVHAPH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|