C17H16BrClN2O2S — CID 3579941
3-(4-aminobutyl)-2-(5-bromothiophen-2-yl)-7-chloro-1H-indole-4-carboxylic acid (PubChem CID 3579941) has the molecular formula C17H16BrClN2O2S and a molecular weight of 427.75 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-(5-bromothiophen-2-yl)-7-chloro-1H-indole-4-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-2-(5-bromothiophen-2-yl)-7-chloro-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 3579941 |
| Molecular Formula | C17H16BrClN2O2S |
| Molecular Weight | 427.75 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | 3-(4-aminobutyl)-2-(5-bromothiophen-2-yl)-7-chloro-1H-indole-4-carboxylic acid |
| SMILES | NCCCCc1c(-c2ccc(Br)s2)[nH]c2c(Cl)ccc(C(=O)O)c12 |
| InChI | InChI=1S/C17H16BrClN2O2S/c18-13-7-6-12(24-13)15-9(3-1-2-8-20)14-10(17(22)23)4-5-11(19)16(14)21-15/h4-7,21H,1-3,8,20H2,(H,22,23) |
| InChIKey | UMZKCTMDUJCMTK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.75 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|