C20H21ClN2O3 — CID 3383399
3-(4-aminobutyl)-7-chloro-2-(3-methoxyphenyl)-1H-indole-4-carboxylic acid (PubChem CID 3383399) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is 3-(4-aminobutyl)-7-chloro-2-(3-methoxyphenyl)-1H-indole-4-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-7-chloro-2-(3-methoxyphenyl)-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 3383399 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 3-(4-aminobutyl)-7-chloro-2-(3-methoxyphenyl)-1H-indole-4-carboxylic acid |
| SMILES | COc1cccc(-c2[nH]c3c(Cl)ccc(C(=O)O)c3c2CCCCN)c1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-26-13-6-4-5-12(11-13)18-14(7-2-3-10-22)17-15(20(24)25)8-9-16(21)19(17)23-18/h4-6,8-9,11,23H,2-3,7,10,22H2,1H3,(H,24,25) |
| InChIKey | ZBJFHBHZXDLNHH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|